C28H50O3Si — CID 46197729
(2R,3R,4S,5R,6R)-2-[(3S,4E,7S,9S)-10-(hydroxymethyl)-3,5,7,9-tetramethylundeca-4,10-dienyl]-3,5-dimethyl-6-(2-trimethylsilylethynyl)oxan-4-ol (PubChem CID 46197729) has the molecular formula C28H50O3Si and a molecular weight of 462.79 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-[(3S,4E,7S,9S)-10-(hydroxymethyl)-3,5,7,9-tetramethylundeca-4,10-dienyl]-3,5-dimethyl-6-(2-trimethylsilylethynyl)oxan-4-ol.
| Compound Name | (2R,3R,4S,5R,6R)-2-[(3S,4E,7S,9S)-10-(hydroxymethyl)-3,5,7,9-tetramethylundeca-4,10-dienyl]-3,5-dimethyl-6-(2-trimethylsilylethynyl)oxan-4-ol |
|---|---|
| PubChem CID | 46197729 |
| Molecular Formula | C28H50O3Si |
| Molecular Weight | 462.79 g/mol |
| Exact Mass | 462.35 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-[(3S,4E,7S,9S)-10-(hydroxymethyl)-3,5,7,9-tetramethylundeca-4,10-dienyl]-3,5-dimethyl-6-(2-trimethylsilylethynyl)oxan-4-ol |
| SMILES | C=C(CO)[C@@H](C)C[C@H](C)C/C(C)=C/[C@@H](C)CC[C@H]1O[C@@H](C#C[Si](C)(C)C)[C@H](C)[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C28H50O3Si/c1-19(15-20(2)16-21(3)17-22(4)23(5)18-29)11-12-26-24(6)28(30)25(7)27(31-26)13-14-32(8,9)10/h15,19,21-22,24-30H,5,11-12,16-18H2,1-4,6-10H3/b20-15+/t19-,21+,22-,24-,25-,26+,27-,28-/m0/s1 |
| InChIKey | PVEXIEQQGAPPEI-BQCAMUDKSA-N |
| XLogP | 6.23 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.79 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|