C31H56O3Si — CID 154709049
(E,3S,5S,9S)-11-[(2R,3S,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-ethynyl-3,5-dimethyloxan-2-yl]-3,5,7,9-tetramethyl-2-methylideneundec-7-en-1-ol (PubChem CID 154709049) has the molecular formula C31H56O3Si and a molecular weight of 504.87 g/mol. Its IUPAC name is (E,3S,5S,9S)-11-[(2R,3S,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-ethynyl-3,5-dimethyloxan-2-yl]-3,5,7,9-tetramethyl-2-methylideneundec-7-en-1-ol.
| Compound Name | (E,3S,5S,9S)-11-[(2R,3S,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-ethynyl-3,5-dimethyloxan-2-yl]-3,5,7,9-tetramethyl-2-methylideneundec-7-en-1-ol |
|---|---|
| PubChem CID | 154709049 |
| Molecular Formula | C31H56O3Si |
| Molecular Weight | 504.87 g/mol |
| Exact Mass | 504.40 |
| IUPAC Name | (E,3S,5S,9S)-11-[(2R,3S,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-ethynyl-3,5-dimethyloxan-2-yl]-3,5,7,9-tetramethyl-2-methylideneundec-7-en-1-ol |
| SMILES | C#C[C@@H]1O[C@H](CC[C@H](C)/C=C(\C)C[C@@H](C)C[C@H](C)C(=C)CO)[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C31H56O3Si/c1-14-28-26(7)30(34-35(12,13)31(9,10)11)27(8)29(33-28)16-15-21(2)17-22(3)18-23(4)19-24(5)25(6)20-32/h1,17,21,23-24,26-30,32H,6,15-16,18-20H2,2-5,7-13H3/b22-17+/t21-,23+,24-,26-,27-,28-,29+,30+/m0/s1 |
| InChIKey | DWVJYQJZUARDQJ-SLVXSBDFSA-N |
| XLogP | 8.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.87 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|