C20H38O4Si — CID 10571229
(E,4R,6S,7R,8S,10S)-6,8-dimethoxy-4,10-dimethyl-13-trimethylsilyltridec-2-en-12-yne-1,7-diol (PubChem CID 10571229) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is (E,4R,6S,7R,8S,10S)-6,8-dimethoxy-4,10-dimethyl-13-trimethylsilyltridec-2-en-12-yne-1,7-diol.
| Compound Name | (E,4R,6S,7R,8S,10S)-6,8-dimethoxy-4,10-dimethyl-13-trimethylsilyltridec-2-en-12-yne-1,7-diol |
|---|---|
| PubChem CID | 10571229 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | (E,4R,6S,7R,8S,10S)-6,8-dimethoxy-4,10-dimethyl-13-trimethylsilyltridec-2-en-12-yne-1,7-diol |
| SMILES | CO[C@@H](C[C@@H](C)CC#C[Si](C)(C)C)[C@@H](O)[C@H](C[C@@H](C)/C=C/CO)OC |
| InChI | InChI=1S/C20H38O4Si/c1-16(10-8-12-21)14-18(23-3)20(22)19(24-4)15-17(2)11-9-13-25(5,6)7/h8,10,16-22H,11-12,14-15H2,1-7H3/b10-8+/t16-,17-,18-,19-,20-/m0/s1 |
| InChIKey | LKWFOCWBVMBMHH-MKOMLMTRSA-N |
| XLogP | 3.25 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|