C21H42O3Si — CID 11383128
(E,2S)-1-[(2S,5S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyloxan-2-yl]-6-methylhept-3-en-2-ol (PubChem CID 11383128) has the molecular formula C21H42O3Si and a molecular weight of 370.65 g/mol. Its IUPAC name is (E,2S)-1-[(2S,5S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyloxan-2-yl]-6-methylhept-3-en-2-ol.
| Compound Name | (E,2S)-1-[(2S,5S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyloxan-2-yl]-6-methylhept-3-en-2-ol |
|---|---|
| PubChem CID | 11383128 |
| Molecular Formula | C21H42O3Si |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | (E,2S)-1-[(2S,5S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyloxan-2-yl]-6-methylhept-3-en-2-ol |
| SMILES | CC(C)C/C=C/[C@@H](O)C[C@@H]1CC[C@H](C)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C21H42O3Si/c1-16(2)10-9-11-18(22)14-19-13-12-17(3)20(24-19)15-23-25(7,8)21(4,5)6/h9,11,16-20,22H,10,12-15H2,1-8H3/b11-9+/t17-,18+,19-,20+/m0/s1 |
| InChIKey | WOHQRTNZKNOQJW-BNQNGLAASA-N |
| XLogP | 5.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|