C24H42O2Si — CID 177430898
(1S,6E,12S)-12-prop-1-en-2-yl-8-tri(propan-2-yl)silyloxycyclododec-6-en-2-yn-1-ol (PubChem CID 177430898) has the molecular formula C24H42O2Si and a molecular weight of 390.68 g/mol. Its IUPAC name is (1S,6E,12S)-12-prop-1-en-2-yl-8-tri(propan-2-yl)silyloxycyclododec-6-en-2-yn-1-ol.
| Compound Name | (1S,6E,12S)-12-prop-1-en-2-yl-8-tri(propan-2-yl)silyloxycyclododec-6-en-2-yn-1-ol |
|---|---|
| PubChem CID | 177430898 |
| Molecular Formula | C24H42O2Si |
| Molecular Weight | 390.68 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | (1S,6E,12S)-12-prop-1-en-2-yl-8-tri(propan-2-yl)silyloxycyclododec-6-en-2-yn-1-ol |
| SMILES | C=C(C)[C@@H]1CCCC(O[Si](C(C)C)(C(C)C)C(C)C)/C=C/CCC#C[C@H]1O |
| InChI | InChI=1S/C24H42O2Si/c1-18(2)23-16-13-15-22(14-11-9-10-12-17-24(23)25)26-27(19(3)4,20(5)6)21(7)8/h11,14,19-25H,1,9-10,13,15-16H2,2-8H3/b14-11+/t22?,23-,24+/m0/s1 |
| InChIKey | UWWKYWNMSMGLIP-CREROQFMSA-N |
| XLogP | 6.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.68 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|