C22H40O5Si — CID 10669392
ethyl (E,4R,6S,7R,8S,10S)-7-hydroxy-6,8-dimethoxy-4,10-dimethyl-13-trimethylsilyltridec-2-en-12-ynoate (PubChem CID 10669392) has the molecular formula C22H40O5Si and a molecular weight of 412.64 g/mol. Its IUPAC name is ethyl (E,4R,6S,7R,8S,10S)-7-hydroxy-6,8-dimethoxy-4,10-dimethyl-13-trimethylsilyltridec-2-en-12-ynoate.
| Compound Name | ethyl (E,4R,6S,7R,8S,10S)-7-hydroxy-6,8-dimethoxy-4,10-dimethyl-13-trimethylsilyltridec-2-en-12-ynoate |
|---|---|
| PubChem CID | 10669392 |
| Molecular Formula | C22H40O5Si |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | ethyl (E,4R,6S,7R,8S,10S)-7-hydroxy-6,8-dimethoxy-4,10-dimethyl-13-trimethylsilyltridec-2-en-12-ynoate |
| SMILES | CCOC(=O)/C=C/[C@H](C)C[C@H](OC)[C@H](O)[C@H](C[C@@H](C)CC#C[Si](C)(C)C)OC |
| InChI | InChI=1S/C22H40O5Si/c1-9-27-21(23)13-12-18(3)16-20(26-5)22(24)19(25-4)15-17(2)11-10-14-28(6,7)8/h12-13,17-20,22,24H,9,11,15-16H2,1-8H3/b13-12+/t17-,18-,19-,20-,22+/m0/s1 |
| InChIKey | XTXNGNHEYXZFPH-RVBGOIHISA-N |
| XLogP | 3.82 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|