C24H48O3Si — CID 11292850
[(2S,3S,6S)-3-methyl-6-[(E,2S)-6-methyl-2-tri(propan-2-yl)silyloxyhept-3-enyl]oxan-2-yl]methanol (PubChem CID 11292850) has the molecular formula C24H48O3Si and a molecular weight of 412.73 g/mol. Its IUPAC name is [(2S,3S,6S)-3-methyl-6-[(E,2S)-6-methyl-2-tri(propan-2-yl)silyloxyhept-3-enyl]oxan-2-yl]methanol.
| Compound Name | [(2S,3S,6S)-3-methyl-6-[(E,2S)-6-methyl-2-tri(propan-2-yl)silyloxyhept-3-enyl]oxan-2-yl]methanol |
|---|---|
| PubChem CID | 11292850 |
| Molecular Formula | C24H48O3Si |
| Molecular Weight | 412.73 g/mol |
| Exact Mass | 412.34 |
| IUPAC Name | [(2S,3S,6S)-3-methyl-6-[(E,2S)-6-methyl-2-tri(propan-2-yl)silyloxyhept-3-enyl]oxan-2-yl]methanol |
| SMILES | CC(C)C/C=C/[C@H](C[C@@H]1CC[C@H](C)[C@@H](CO)O1)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H48O3Si/c1-17(2)11-10-12-23(15-22-14-13-21(9)24(16-25)26-22)27-28(18(3)4,19(5)6)20(7)8/h10,12,17-25H,11,13-16H2,1-9H3/b12-10+/t21-,22-,23+,24+/m0/s1 |
| InChIKey | VIEWQESTMXLOHJ-GRIOZMCCSA-N |
| XLogP | 6.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.73 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|