C22H42O3Si — CID 135022083
(6R,8E,10Z,12E)-14-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyltetradeca-8,10,12-triene-2,3-diol (PubChem CID 135022083) has the molecular formula C22H42O3Si and a molecular weight of 382.66 g/mol. Its IUPAC name is (6R,8E,10Z,12E)-14-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyltetradeca-8,10,12-triene-2,3-diol.
| Compound Name | (6R,8E,10Z,12E)-14-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyltetradeca-8,10,12-triene-2,3-diol |
|---|---|
| PubChem CID | 135022083 |
| Molecular Formula | C22H42O3Si |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | (6R,8E,10Z,12E)-14-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyltetradeca-8,10,12-triene-2,3-diol |
| SMILES | C[C@@H](C/C=C/C=C\C=C\CO[Si](C)(C)C(C)(C)C)CCC(O)C(C)(C)O |
| InChI | InChI=1S/C22H42O3Si/c1-19(16-17-20(23)22(5,6)24)15-13-11-9-10-12-14-18-25-26(7,8)21(2,3)4/h9-14,19-20,23-24H,15-18H2,1-8H3/b10-9-,13-11+,14-12+/t19-,20?/m0/s1 |
| InChIKey | VBZMNFVZKLJOSQ-HXWOFLSZSA-N |
| XLogP | 5.61 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|