C32H70O4Si3 — CID 45103009
(E,2R,6S,7R,9S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-2,6,9-trimethyl-2,7-bis(triethylsilyloxy)undec-3-en-1-ol (PubChem CID 45103009) has the molecular formula C32H70O4Si3 and a molecular weight of 603.17 g/mol. Its IUPAC name is (E,2R,6S,7R,9S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-2,6,9-trimethyl-2,7-bis(triethylsilyloxy)undec-3-en-1-ol.
| Compound Name | (E,2R,6S,7R,9S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-2,6,9-trimethyl-2,7-bis(triethylsilyloxy)undec-3-en-1-ol |
|---|---|
| PubChem CID | 45103009 |
| Molecular Formula | C32H70O4Si3 |
| Molecular Weight | 603.17 g/mol |
| Exact Mass | 602.46 |
| IUPAC Name | (E,2R,6S,7R,9S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-2,6,9-trimethyl-2,7-bis(triethylsilyloxy)undec-3-en-1-ol |
| SMILES | CC[Si](CC)(CC)O[C@H](C[C@H](C)[C@H](C)O[Si](C)(C)C(C)(C)C)[C@@H](C)C/C=C/[C@](C)(CO)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C32H70O4Si3/c1-16-38(17-2,18-3)35-30(25-28(8)29(9)34-37(14,15)31(10,11)12)27(7)23-22-24-32(13,26-33)36-39(19-4,20-5)21-6/h22,24,27-30,33H,16-21,23,25-26H2,1-15H3/b24-22+/t27-,28-,29-,30+,32+/m0/s1 |
| InChIKey | ZAEVPEYZWBMDJH-WMFKQDDBSA-N |
| XLogP | 10.17 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.17 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|