C23H44O2Si — CID 19835946
3-[3-[tert-butyl(dimethyl)silyl]oxy-3-methyloctyl]-2-prop-2-enylcyclopent-3-en-1-ol (PubChem CID 19835946) has the molecular formula C23H44O2Si and a molecular weight of 380.69 g/mol. Its IUPAC name is 3-[3-[tert-butyl(dimethyl)silyl]oxy-3-methyloctyl]-2-prop-2-enylcyclopent-3-en-1-ol.
| Compound Name | 3-[3-[tert-butyl(dimethyl)silyl]oxy-3-methyloctyl]-2-prop-2-enylcyclopent-3-en-1-ol |
|---|---|
| PubChem CID | 19835946 |
| Molecular Formula | C23H44O2Si |
| Molecular Weight | 380.69 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | 3-[3-[tert-butyl(dimethyl)silyl]oxy-3-methyloctyl]-2-prop-2-enylcyclopent-3-en-1-ol |
| SMILES | C=CCC1C(CCC(C)(CCCCC)O[Si](C)(C)C(C)(C)C)=CCC1O |
| InChI | InChI=1S/C23H44O2Si/c1-9-11-12-17-23(6,25-26(7,8)22(3,4)5)18-16-19-14-15-21(24)20(19)13-10-2/h10,14,20-21,24H,2,9,11-13,15-18H2,1,3-8H3 |
| InChIKey | LFVXTJNABYQQGK-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.69 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|