C40H62O6Si — CID 18636918
7-[(1R,2R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyloctyl]-3-hydroxy-5-(4-phenylbenzoyl)oxycyclopentyl]heptanoic acid (PubChem CID 18636918) has the molecular formula C40H62O6Si and a molecular weight of 667.02 g/mol. Its IUPAC name is 7-[(1R,2R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyloctyl]-3-hydroxy-5-(4-phenylbenzoyl)oxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyloctyl]-3-hydroxy-5-(4-phenylbenzoyl)oxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 18636918 |
| Molecular Formula | C40H62O6Si |
| Molecular Weight | 667.02 g/mol |
| Exact Mass | 666.43 |
| IUPAC Name | 7-[(1R,2R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyloctyl]-3-hydroxy-5-(4-phenylbenzoyl)oxycyclopentyl]heptanoic acid |
| SMILES | CCCCC[C@@](C)(CC[C@H]1C(O)C[C@H](OC(=O)c2ccc(-c3ccccc3)cc2)[C@@H]1CCCCCCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C40H62O6Si/c1-8-9-17-27-40(5,46-47(6,7)39(2,3)4)28-26-33-34(20-15-10-11-16-21-37(42)43)36(29-35(33)41)45-38(44)32-24-22-31(23-25-32)30-18-13-12-14-19-30/h12-14,18-19,22-25,33-36,41H,8-11,15-17,20-21,26-29H2,1-7H3,(H,42,43)/t33-,34-,35?,36+,40+/m1/s1 |
| InChIKey | KUCMTBUSEAGSQB-OGRWBTRSSA-N |
| XLogP | 10.44 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.02 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|