C40H62O6Si — CID 57038068
2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,2R,5S)-3-hydroxy-1-methyl-2-octyl-5-(4-phenylbenzoyl)oxycyclopentyl]heptanoic acid (PubChem CID 57038068) has the molecular formula C40H62O6Si and a molecular weight of 667.02 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,2R,5S)-3-hydroxy-1-methyl-2-octyl-5-(4-phenylbenzoyl)oxycyclopentyl]heptanoic acid.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,2R,5S)-3-hydroxy-1-methyl-2-octyl-5-(4-phenylbenzoyl)oxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 57038068 |
| Molecular Formula | C40H62O6Si |
| Molecular Weight | 667.02 g/mol |
| Exact Mass | 666.43 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,2R,5S)-3-hydroxy-1-methyl-2-octyl-5-(4-phenylbenzoyl)oxycyclopentyl]heptanoic acid |
| SMILES | CCCCCCCC[C@H]1C(O)C[C@H](OC(=O)c2ccc(-c3ccccc3)cc2)[C@]1(C)CCCCCC(O[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C40H62O6Si/c1-8-9-10-11-12-17-22-33-34(41)29-36(45-38(44)32-26-24-31(25-27-32)30-20-15-13-16-21-30)40(33,5)28-19-14-18-23-35(37(42)43)46-47(6,7)39(2,3)4/h13,15-16,20-21,24-27,33-36,41H,8-12,14,17-19,22-23,28-29H2,1-7H3,(H,42,43)/t33-,34?,35?,36-,40+/m0/s1 |
| InChIKey | FINQSNVJONCMPB-CSGRSNQXSA-N |
| XLogP | 10.44 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.02 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|