C41H62O5Si — CID 57265153
2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,5S)-2-(4-methylnonyl)-5-(4-phenylbenzoyl)oxycyclopent-2-en-1-yl]heptanoic acid (PubChem CID 57265153) has the molecular formula C41H62O5Si and a molecular weight of 663.03 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,5S)-2-(4-methylnonyl)-5-(4-phenylbenzoyl)oxycyclopent-2-en-1-yl]heptanoic acid.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,5S)-2-(4-methylnonyl)-5-(4-phenylbenzoyl)oxycyclopent-2-en-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 57265153 |
| Molecular Formula | C41H62O5Si |
| Molecular Weight | 663.03 g/mol |
| Exact Mass | 662.44 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,5S)-2-(4-methylnonyl)-5-(4-phenylbenzoyl)oxycyclopent-2-en-1-yl]heptanoic acid |
| SMILES | CCCCCC(C)CCCC1=CC[C@H](OC(=O)c2ccc(-c3ccccc3)cc2)[C@@H]1CCCCCC(O[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C41H62O5Si/c1-8-9-12-18-31(2)19-17-22-34-29-30-37(45-40(44)35-27-25-33(26-28-35)32-20-13-10-14-21-32)36(34)23-15-11-16-24-38(39(42)43)46-47(6,7)41(3,4)5/h10,13-14,20-21,25-29,31,36-38H,8-9,11-12,15-19,22-24,30H2,1-7H3,(H,42,43)/t31?,36-,37+,38?/m1/s1 |
| InChIKey | NAMYSJVLNOBKRE-IXJDIOITSA-N |
| XLogP | 11.64 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.03 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|