C42H56O6Si — CID 57092523
2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,5S)-2-(4-phenoxypentyl)-5-(4-phenylbenzoyl)oxycyclopent-2-en-1-yl]heptanoic acid (PubChem CID 57092523) has the molecular formula C42H56O6Si and a molecular weight of 684.99 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,5S)-2-(4-phenoxypentyl)-5-(4-phenylbenzoyl)oxycyclopent-2-en-1-yl]heptanoic acid.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,5S)-2-(4-phenoxypentyl)-5-(4-phenylbenzoyl)oxycyclopent-2-en-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 57092523 |
| Molecular Formula | C42H56O6Si |
| Molecular Weight | 684.99 g/mol |
| Exact Mass | 684.38 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,5S)-2-(4-phenoxypentyl)-5-(4-phenylbenzoyl)oxycyclopent-2-en-1-yl]heptanoic acid |
| SMILES | CC(CCCC1=CC[C@H](OC(=O)c2ccc(-c3ccccc3)cc2)[C@@H]1CCCCCC(O[Si](C)(C)C(C)(C)C)C(=O)O)Oc1ccccc1 |
| InChI | InChI=1S/C42H56O6Si/c1-31(46-36-21-12-8-13-22-36)17-16-20-34-29-30-38(47-41(45)35-27-25-33(26-28-35)32-18-10-7-11-19-32)37(34)23-14-9-15-24-39(40(43)44)48-49(5,6)42(2,3)4/h7-8,10-13,18-19,21-22,25-29,31,37-39H,9,14-17,20,23-24,30H2,1-6H3,(H,43,44)/t31?,37-,38+,39?/m1/s1 |
| InChIKey | ZAAAEEATJRYUBV-TZXHJRCYSA-N |
| XLogP | 10.89 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.99 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|