C46H72O7Si — CID 18636929
7-[(1R,2R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylnonyl]-3-(oxan-2-yloxy)-5-(4-phenylbenzoyl)oxycyclopentyl]heptanoic acid (PubChem CID 18636929) has the molecular formula C46H72O7Si and a molecular weight of 765.16 g/mol. Its IUPAC name is 7-[(1R,2R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylnonyl]-3-(oxan-2-yloxy)-5-(4-phenylbenzoyl)oxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylnonyl]-3-(oxan-2-yloxy)-5-(4-phenylbenzoyl)oxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 18636929 |
| Molecular Formula | C46H72O7Si |
| Molecular Weight | 765.16 g/mol |
| Exact Mass | 764.50 |
| IUPAC Name | 7-[(1R,2R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylnonyl]-3-(oxan-2-yloxy)-5-(4-phenylbenzoyl)oxycyclopentyl]heptanoic acid |
| SMILES | CCCCCC(C)[C@H](CC[C@H]1C(OC2CCCCO2)C[C@H](OC(=O)c2ccc(-c3ccccc3)cc2)[C@@H]1CCCCCCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C46H72O7Si/c1-8-9-13-20-34(2)40(53-54(6,7)46(3,4)5)31-30-39-38(23-16-10-11-17-24-43(47)48)42(33-41(39)51-44-25-18-19-32-50-44)52-45(49)37-28-26-36(27-29-37)35-21-14-12-15-22-35/h12,14-15,21-22,26-29,34,38-42,44H,8-11,13,16-20,23-25,30-33H2,1-7H3,(H,47,48)/t34?,38-,39-,40+,41?,42+,44?/m1/s1 |
| InChIKey | YNEMHEQIDVRSLP-HVZZFENLSA-N |
| XLogP | 12.24 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.16 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|