C40H60O8 — CID 13080756
[(1S,2R,3R,4R)-3-[(1E,3S)-4,7-dimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-2-(7-methoxy-7-oxoheptyl)-4-(oxan-2-yloxy)cyclopentyl] benzoate (PubChem CID 13080756) has the molecular formula C40H60O8 and a molecular weight of 668.91 g/mol. Its IUPAC name is [(1S,2R,3R,4R)-3-[(1E,3S)-4,7-dimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-2-(7-methoxy-7-oxoheptyl)-4-(oxan-2-yloxy)cyclopentyl] benzoate.
| Compound Name | [(1S,2R,3R,4R)-3-[(1E,3S)-4,7-dimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-2-(7-methoxy-7-oxoheptyl)-4-(oxan-2-yloxy)cyclopentyl] benzoate |
|---|---|
| PubChem CID | 13080756 |
| Molecular Formula | C40H60O8 |
| Molecular Weight | 668.91 g/mol |
| Exact Mass | 668.43 |
| IUPAC Name | [(1S,2R,3R,4R)-3-[(1E,3S)-4,7-dimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-2-(7-methoxy-7-oxoheptyl)-4-(oxan-2-yloxy)cyclopentyl] benzoate |
| SMILES | COC(=O)CCCCCC[C@@H]1[C@@H](/C=C/[C@@H](OC2CCCCO2)C(C)CC=C(C)C)[C@H](OC2CCCCO2)C[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C40H60O8/c1-29(2)22-23-30(3)34(46-38-20-12-14-26-44-38)25-24-33-32(18-10-5-6-11-19-37(41)43-4)36(48-40(42)31-16-8-7-9-17-31)28-35(33)47-39-21-13-15-27-45-39/h7-9,16-17,22,24-25,30,32-36,38-39H,5-6,10-15,18-21,23,26-28H2,1-4H3/b25-24+/t30?,32-,33-,34-,35-,36+,38?,39?/m1/s1 |
| InChIKey | UBXRAFMWVPZNFN-YHSDJSKOSA-N |
| XLogP | 8.73 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.91 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|