C31H46O7 — CID 138469721
methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E)-7-cyclopropyl-4-methyl-3-oxohept-1-en-6-ynyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate (PubChem CID 138469721) has the molecular formula C31H46O7 and a molecular weight of 530.70 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E)-7-cyclopropyl-4-methyl-3-oxohept-1-en-6-ynyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E)-7-cyclopropyl-4-methyl-3-oxohept-1-en-6-ynyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 138469721 |
| Molecular Formula | C31H46O7 |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 530.32 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E)-7-cyclopropyl-4-methyl-3-oxohept-1-en-6-ynyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@@H]1[C@@H](/C=C/C(=O)C(C)CC#CC2CC2)[C@H](OC2CCCCO2)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C31H46O7/c1-22(11-10-12-24-16-17-24)27(33)19-18-26-25(13-6-4-5-7-14-30(34)35-3)28(37-23(2)32)21-29(26)38-31-15-8-9-20-36-31/h18-19,22,24-26,28-29,31H,4-9,11,13-17,20-21H2,1-3H3/b19-18+/t22?,25-,26-,28+,29-,31?/m1/s1 |
| InChIKey | IOTKGCJTROGKMC-GSCOYQGQSA-N |
| XLogP | 5.54 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|