C31H48O8 — CID 70588457
methyl 7-[(1R,2R,3R,5S)-3,5-diacetyloxy-2-[3-methyl-3-(oxan-2-yloxy)oct-1-en-6-ynyl]cyclopentyl]heptanoate (PubChem CID 70588457) has the molecular formula C31H48O8 and a molecular weight of 548.72 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-3,5-diacetyloxy-2-[3-methyl-3-(oxan-2-yloxy)oct-1-en-6-ynyl]cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-3,5-diacetyloxy-2-[3-methyl-3-(oxan-2-yloxy)oct-1-en-6-ynyl]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 70588457 |
| Molecular Formula | C31H48O8 |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.33 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-3,5-diacetyloxy-2-[3-methyl-3-(oxan-2-yloxy)oct-1-en-6-ynyl]cyclopentyl]heptanoate |
| SMILES | CC#CCCC(C)(C=C[C@@H]1[C@@H](CCCCCCC(=O)OC)[C@@H](OC(C)=O)C[C@H]1OC(C)=O)OC1CCCCO1 |
| InChI | InChI=1S/C31H48O8/c1-6-7-13-19-31(4,39-30-17-12-14-21-36-30)20-18-26-25(15-10-8-9-11-16-29(34)35-5)27(37-23(2)32)22-28(26)38-24(3)33/h18,20,25-28,30H,8-17,19,21-22H2,1-5H3/t25-,26-,27+,28-,30?,31?/m1/s1 |
| InChIKey | XITUMLFLFYIUMA-BKUUTSKLSA-N |
| XLogP | 5.66 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|