C30H40F2O7 — CID 59514701
methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E)-4,4-difluoro-3-oxo-4-phenylbut-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate (PubChem CID 59514701) has the molecular formula C30H40F2O7 and a molecular weight of 550.64 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E)-4,4-difluoro-3-oxo-4-phenylbut-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E)-4,4-difluoro-3-oxo-4-phenylbut-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 59514701 |
| Molecular Formula | C30H40F2O7 |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E)-4,4-difluoro-3-oxo-4-phenylbut-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@@H]1[C@@H](/C=C/C(=O)C(F)(F)c2ccccc2)[C@H](OC2CCCCO2)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H40F2O7/c1-21(33)38-25-20-26(39-29-16-10-11-19-37-29)24(23(25)14-8-3-4-9-15-28(35)36-2)17-18-27(34)30(31,32)22-12-6-5-7-13-22/h5-7,12-13,17-18,23-26,29H,3-4,8-11,14-16,19-20H2,1-2H3/b18-17+/t23-,24-,25+,26-,29?/m1/s1 |
| InChIKey | JFUVHOKBLSXZBN-YFGIZIHFSA-N |
| XLogP | 5.90 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|