C32H51ClO6 — CID 56998868
7-[(1R,2R,3R,5R)-5-chloro-2-[4,7-dimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid (PubChem CID 56998868) has the molecular formula C32H51ClO6 and a molecular weight of 567.21 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5R)-5-chloro-2-[4,7-dimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R,5R)-5-chloro-2-[4,7-dimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 56998868 |
| Molecular Formula | C32H51ClO6 |
| Molecular Weight | 567.21 g/mol |
| Exact Mass | 566.34 |
| IUPAC Name | 7-[(1R,2R,3R,5R)-5-chloro-2-[4,7-dimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
| SMILES | CC(C)=CCC(C)C(C=C[C@@H]1[C@@H](CC=CCCCC(=O)O)[C@H](Cl)C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C32H51ClO6/c1-23(2)16-17-24(3)28(38-31-14-8-10-20-36-31)19-18-26-25(12-6-4-5-7-13-30(34)35)27(33)22-29(26)39-32-15-9-11-21-37-32/h4,6,16,18-19,24-29,31-32H,5,7-15,17,20-22H2,1-3H3,(H,34,35)/t24?,25-,26-,27-,28?,29-,31?,32?/m1/s1 |
| InChIKey | JPMSSVOTYYQGFD-NSWWVZQRSA-N |
| XLogP | 7.80 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.21 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|