C32H52O8 — CID 70576514
(Z)-7-[(1R,2R,3R)-2-[(E)-8-methoxy-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 70576514) has the molecular formula C32H52O8 and a molecular weight of 564.76 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R)-2-[(E)-8-methoxy-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R)-2-[(E)-8-methoxy-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70576514 |
| Molecular Formula | C32H52O8 |
| Molecular Weight | 564.76 g/mol |
| Exact Mass | 564.37 |
| IUPAC Name | (Z)-7-[(1R,2R,3R)-2-[(E)-8-methoxy-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | COCCCCC(C)C(/C=C/[C@H]1[C@H](OC2CCCCO2)CC(=O)[C@@H]1C/C=C\CCCC(=O)O)OC1CCCCO1 |
| InChI | InChI=1S/C32H52O8/c1-24(13-7-10-20-36-2)28(39-31-16-8-11-21-37-31)19-18-26-25(14-5-3-4-6-15-30(34)35)27(33)23-29(26)40-32-17-9-12-22-38-32/h3,5,18-19,24-26,28-29,31-32H,4,6-17,20-23H2,1-2H3,(H,34,35)/b5-3-,19-18+/t24?,25-,26-,28?,29-,31?,32?/m1/s1 |
| InChIKey | BOZPEJIBEFBCMI-SZDAJYIOSA-N |
| XLogP | 6.23 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.76 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|