C50H64O7 — CID 70600397
oxan-2-yl 7-[(1R,2R,3R)-2-[(E)-5-methyl-4-trityloxyoct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]hept-5-enoate (PubChem CID 70600397) has the molecular formula C50H64O7 and a molecular weight of 777.06 g/mol. Its IUPAC name is oxan-2-yl 7-[(1R,2R,3R)-2-[(E)-5-methyl-4-trityloxyoct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | oxan-2-yl 7-[(1R,2R,3R)-2-[(E)-5-methyl-4-trityloxyoct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70600397 |
| Molecular Formula | C50H64O7 |
| Molecular Weight | 777.06 g/mol |
| Exact Mass | 776.47 |
| IUPAC Name | oxan-2-yl 7-[(1R,2R,3R)-2-[(E)-5-methyl-4-trityloxyoct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]hept-5-enoate |
| SMILES | CCCC(C)C(C/C=C/[C@H]1[C@H](OC2CCCCO2)CC(=O)[C@@H]1CC=CCCCC(=O)OC1CCCCO1)OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C50H64O7/c1-3-22-38(2)45(57-50(39-23-9-6-10-24-39,40-25-11-7-12-26-40)41-27-13-8-14-28-41)31-21-30-43-42(44(51)37-46(43)55-48-33-17-19-35-53-48)29-15-4-5-16-32-47(52)56-49-34-18-20-36-54-49/h4,6-15,21,23-28,30,38,42-43,45-46,48-49H,3,5,16-20,22,29,31-37H2,1-2H3/b15-4?,30-21+/t38?,42-,43-,45?,46-,48?,49?/m1/s1 |
| InChIKey | GVHDQSSFNCCVDT-HBFBPKMFSA-N |
| XLogP | 11.05 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.06 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|