C34H46F2O7 — CID 67577250
phenacyl (Z)-7-[(1R,2R,3R)-2-(4,4-difluoro-7-methyl-3-oxooctyl)-3-(oxan-2-yloxy)-5-oxocyclopentyl]hept-5-enoate (PubChem CID 67577250) has the molecular formula C34H46F2O7 and a molecular weight of 604.73 g/mol. Its IUPAC name is phenacyl (Z)-7-[(1R,2R,3R)-2-(4,4-difluoro-7-methyl-3-oxooctyl)-3-(oxan-2-yloxy)-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | phenacyl (Z)-7-[(1R,2R,3R)-2-(4,4-difluoro-7-methyl-3-oxooctyl)-3-(oxan-2-yloxy)-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 67577250 |
| Molecular Formula | C34H46F2O7 |
| Molecular Weight | 604.73 g/mol |
| Exact Mass | 604.32 |
| IUPAC Name | phenacyl (Z)-7-[(1R,2R,3R)-2-(4,4-difluoro-7-methyl-3-oxooctyl)-3-(oxan-2-yloxy)-5-oxocyclopentyl]hept-5-enoate |
| SMILES | CC(C)CCC(F)(F)C(=O)CC[C@H]1[C@H](OC2CCCCO2)CC(=O)[C@@H]1C/C=C\CCCC(=O)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H46F2O7/c1-24(2)19-20-34(35,36)31(39)18-17-27-26(28(37)22-30(27)43-33-16-10-11-21-41-33)14-8-3-4-9-15-32(40)42-23-29(38)25-12-6-5-7-13-25/h3,5-8,12-13,24,26-27,30,33H,4,9-11,14-23H2,1-2H3/b8-3-/t26-,27-,30-,33?/m1/s1 |
| InChIKey | MIBAGQSQSQQRSI-CQKIGJDZSA-N |
| XLogP | 7.07 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.73 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|