C26H42F2O6 — CID 123625827
7-[(1R,2R,3R)-2-[(6S)-4,4-difluoro-6-methyl-3-oxooctyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]heptanoic acid (PubChem CID 123625827) has the molecular formula C26H42F2O6 and a molecular weight of 488.61 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-2-[(6S)-4,4-difluoro-6-methyl-3-oxooctyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R)-2-[(6S)-4,4-difluoro-6-methyl-3-oxooctyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 123625827 |
| Molecular Formula | C26H42F2O6 |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 7-[(1R,2R,3R)-2-[(6S)-4,4-difluoro-6-methyl-3-oxooctyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]heptanoic acid |
| SMILES | CC[C@H](C)CC(F)(F)C(=O)CC[C@H]1[C@H](OC2CCCCO2)CC(=O)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C26H42F2O6/c1-3-18(2)17-26(27,28)23(30)14-13-20-19(10-6-4-5-7-11-24(31)32)21(29)16-22(20)34-25-12-8-9-15-33-25/h18-20,22,25H,3-17H2,1-2H3,(H,31,32)/t18-,19+,20+,22+,25?/m0/s1 |
| InChIKey | USTUQCLBUYPNIP-QKIUHRJVSA-N |
| XLogP | 5.95 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|