C26H42F2O4 — CID 88854011
7-[(1S,2S,3R)-2-[(E,6S)-4,4-difluoro-6-methyl-3-oxooct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanal (PubChem CID 88854011) has the molecular formula C26H42F2O4 and a molecular weight of 456.61 g/mol. Its IUPAC name is 7-[(1S,2S,3R)-2-[(E,6S)-4,4-difluoro-6-methyl-3-oxooct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanal.
| Compound Name | 7-[(1S,2S,3R)-2-[(E,6S)-4,4-difluoro-6-methyl-3-oxooct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanal |
|---|---|
| PubChem CID | 88854011 |
| Molecular Formula | C26H42F2O4 |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | 7-[(1S,2S,3R)-2-[(E,6S)-4,4-difluoro-6-methyl-3-oxooct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanal |
| SMILES | CC[C@H](C)CC(F)(F)C(=O)/C=C/[C@@H]1[C@@H](CCCCCCC=O)CC[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C26H42F2O4/c1-3-20(2)19-26(27,28)24(30)16-14-22-21(11-7-5-4-6-9-17-29)13-15-23(22)32-25-12-8-10-18-31-25/h14,16-17,20-23,25H,3-13,15,18-19H2,1-2H3/b16-14+/t20-,21-,22+,23+,25?/m0/s1 |
| InChIKey | QJAFYLTYYDTBDA-ARBWFRADSA-N |
| XLogP | 6.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|