C22H38F2O3 — CID 144503968
(E,6S)-1-cyclopentyl-4,4-difluoro-6-methyloct-1-en-3-one;methyl heptanoate (PubChem CID 144503968) has the molecular formula C22H38F2O3 and a molecular weight of 388.54 g/mol. Its IUPAC name is (E,6S)-1-cyclopentyl-4,4-difluoro-6-methyloct-1-en-3-one;methyl heptanoate.
| Compound Name | (E,6S)-1-cyclopentyl-4,4-difluoro-6-methyloct-1-en-3-one;methyl heptanoate |
|---|---|
| PubChem CID | 144503968 |
| Molecular Formula | C22H38F2O3 |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | (E,6S)-1-cyclopentyl-4,4-difluoro-6-methyloct-1-en-3-one;methyl heptanoate |
| SMILES | CCCCCCC(=O)OC.CC[C@H](C)CC(F)(F)C(=O)/C=C/C1CCCC1 |
| InChI | InChI=1S/C14H22F2O.C8H16O2/c1-3-11(2)10-14(15,16)13(17)9-8-12-6-4-5-7-12;1-3-4-5-6-7-8(9)10-2/h8-9,11-12H,3-7,10H2,1-2H3;3-7H2,1-2H3/b9-8+;/t11-;/m0./s1 |
| InChIKey | MTXQCYWTYXOTHR-FUBQLQTCSA-N |
| XLogP | 6.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|