C23H36F2O5 — CID 123838331
methyl 7-[(1R,2S,5R)-2-acetyloxy-5-(4,4-difluoro-3-oxooct-1-enyl)cyclopentyl]heptanoate (PubChem CID 123838331) has the molecular formula C23H36F2O5 and a molecular weight of 430.53 g/mol. Its IUPAC name is methyl 7-[(1R,2S,5R)-2-acetyloxy-5-(4,4-difluoro-3-oxooct-1-enyl)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2S,5R)-2-acetyloxy-5-(4,4-difluoro-3-oxooct-1-enyl)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 123838331 |
| Molecular Formula | C23H36F2O5 |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | methyl 7-[(1R,2S,5R)-2-acetyloxy-5-(4,4-difluoro-3-oxooct-1-enyl)cyclopentyl]heptanoate |
| SMILES | CCCCC(F)(F)C(=O)C=C[C@H]1CC[C@H](OC(C)=O)[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C23H36F2O5/c1-4-5-16-23(24,25)21(27)15-13-18-12-14-20(30-17(2)26)19(18)10-8-6-7-9-11-22(28)29-3/h13,15,18-20H,4-12,14,16H2,1-3H3/t18-,19-,20+/m1/s1 |
| InChIKey | CPZJJIICWRTJOJ-AQNXPRMDSA-N |
| XLogP | 5.41 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|