C21H32F2O5 — CID 91081228
methyl 7-[(2S)-2-acetyloxy-5-(4,4-difluoro-3-oxohexylidene)cyclopentyl]heptanoate (PubChem CID 91081228) has the molecular formula C21H32F2O5 and a molecular weight of 402.48 g/mol. Its IUPAC name is methyl 7-[(2S)-2-acetyloxy-5-(4,4-difluoro-3-oxohexylidene)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(2S)-2-acetyloxy-5-(4,4-difluoro-3-oxohexylidene)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 91081228 |
| Molecular Formula | C21H32F2O5 |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | methyl 7-[(2S)-2-acetyloxy-5-(4,4-difluoro-3-oxohexylidene)cyclopentyl]heptanoate |
| SMILES | CCC(F)(F)C(=O)CC=C1CC[C@H](OC(C)=O)C1CCCCCCC(=O)OC |
| InChI | InChI=1S/C21H32F2O5/c1-4-21(22,23)19(25)14-12-16-11-13-18(28-15(2)24)17(16)9-7-5-6-8-10-20(26)27-3/h12,17-18H,4-11,13-14H2,1-3H3/t17?,18-/m0/s1 |
| InChIKey | QCLWIVYAQBIDLB-ZVAWYAOSSA-N |
| XLogP | 4.77 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|