C22H40O4 — CID 70615508
methyl 7-[(1R,2S)-2-hydroxy-5-(3-hydroxy-3-methyloctylidene)cyclopentyl]heptanoate (PubChem CID 70615508) has the molecular formula C22H40O4 and a molecular weight of 368.56 g/mol. Its IUPAC name is methyl 7-[(1R,2S)-2-hydroxy-5-(3-hydroxy-3-methyloctylidene)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2S)-2-hydroxy-5-(3-hydroxy-3-methyloctylidene)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 70615508 |
| Molecular Formula | C22H40O4 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | methyl 7-[(1R,2S)-2-hydroxy-5-(3-hydroxy-3-methyloctylidene)cyclopentyl]heptanoate |
| SMILES | CCCCCC(C)(O)CC=C1CC[C@H](O)[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C22H40O4/c1-4-5-10-16-22(2,25)17-15-18-13-14-20(23)19(18)11-8-6-7-9-12-21(24)26-3/h15,19-20,23,25H,4-14,16-17H2,1-3H3/t19-,20+,22?/m1/s1 |
| InChIKey | RQGQBTKYPLUTFN-MFCMXAAESA-N |
| XLogP | 4.92 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|