C22H40O4 — CID 54350398
methyl 7-[(1R,2S)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]-2-methylheptanoate (PubChem CID 54350398) has the molecular formula C22H40O4 and a molecular weight of 368.56 g/mol. Its IUPAC name is methyl 7-[(1R,2S)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]-2-methylheptanoate.
| Compound Name | methyl 7-[(1R,2S)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]-2-methylheptanoate |
|---|---|
| PubChem CID | 54350398 |
| Molecular Formula | C22H40O4 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | methyl 7-[(1R,2S)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]-2-methylheptanoate |
| SMILES | CCCCCC(O)CC=C1CC[C@H](O)[C@@H]1CCCCCC(C)C(=O)OC |
| InChI | InChI=1S/C22H40O4/c1-4-5-7-11-19(23)15-13-18-14-16-21(24)20(18)12-9-6-8-10-17(2)22(25)26-3/h13,17,19-21,23-24H,4-12,14-16H2,1-3H3/t17?,19?,20-,21+/m1/s1 |
| InChIKey | UFHSJSPQEHBVMM-HXJFWZBSSA-N |
| XLogP | 4.77 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|