C27H50O4 — CID 54307574
ethyl 7-[(1R,2S)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]-2-pentan-3-ylheptanoate (PubChem CID 54307574) has the molecular formula C27H50O4 and a molecular weight of 438.69 g/mol. Its IUPAC name is ethyl 7-[(1R,2S)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]-2-pentan-3-ylheptanoate.
| Compound Name | ethyl 7-[(1R,2S)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]-2-pentan-3-ylheptanoate |
|---|---|
| PubChem CID | 54307574 |
| Molecular Formula | C27H50O4 |
| Molecular Weight | 438.69 g/mol |
| Exact Mass | 438.37 |
| IUPAC Name | ethyl 7-[(1R,2S)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]-2-pentan-3-ylheptanoate |
| SMILES | CCCCCC(O)CC=C1CC[C@H](O)[C@@H]1CCCCCC(C(=O)OCC)C(CC)CC |
| InChI | InChI=1S/C27H50O4/c1-5-9-11-14-23(28)19-17-22-18-20-26(29)24(22)15-12-10-13-16-25(21(6-2)7-3)27(30)31-8-4/h17,21,23-26,28-29H,5-16,18-20H2,1-4H3/t23?,24-,25?,26+/m1/s1 |
| InChIKey | SIPLUFDNEWGOAS-WRGVWOLQSA-N |
| XLogP | 6.58 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.69 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|