C22H38O4 — CID 54357431
ethyl 7-[(1R,2R)-2-hydroxy-5-octylidenecyclopentyl]-2-oxoheptanoate (PubChem CID 54357431) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is ethyl 7-[(1R,2R)-2-hydroxy-5-octylidenecyclopentyl]-2-oxoheptanoate.
| Compound Name | ethyl 7-[(1R,2R)-2-hydroxy-5-octylidenecyclopentyl]-2-oxoheptanoate |
|---|---|
| PubChem CID | 54357431 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | ethyl 7-[(1R,2R)-2-hydroxy-5-octylidenecyclopentyl]-2-oxoheptanoate |
| SMILES | CCCCCCCC=C1CC[C@@H](O)[C@@H]1CCCCCC(=O)C(=O)OCC |
| InChI | InChI=1S/C22H38O4/c1-3-5-6-7-8-10-13-18-16-17-20(23)19(18)14-11-9-12-15-21(24)22(25)26-4-2/h13,19-20,23H,3-12,14-17H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | UKCFCBJFYFTXED-WOJBJXKFSA-N |
| XLogP | 5.13 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|