C24H44O4 — CID 54298810
ethyl 7-[(1R,2R)-2-hydroxy-5-(3-hydroxy-4,4-dimethyloctylidene)cyclopentyl]heptanoate (PubChem CID 54298810) has the molecular formula C24H44O4 and a molecular weight of 396.61 g/mol. Its IUPAC name is ethyl 7-[(1R,2R)-2-hydroxy-5-(3-hydroxy-4,4-dimethyloctylidene)cyclopentyl]heptanoate.
| Compound Name | ethyl 7-[(1R,2R)-2-hydroxy-5-(3-hydroxy-4,4-dimethyloctylidene)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 54298810 |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | ethyl 7-[(1R,2R)-2-hydroxy-5-(3-hydroxy-4,4-dimethyloctylidene)cyclopentyl]heptanoate |
| SMILES | CCCCC(C)(C)C(O)CC=C1CC[C@@H](O)[C@@H]1CCCCCCC(=O)OCC |
| InChI | InChI=1S/C24H44O4/c1-5-7-18-24(3,4)22(26)17-15-19-14-16-21(25)20(19)12-10-8-9-11-13-23(27)28-6-2/h15,20-22,25-26H,5-14,16-18H2,1-4H3/t20-,21-,22?/m1/s1 |
| InChIKey | SCRZOSNTFZNEHE-JAZPPYFYSA-N |
| XLogP | 5.55 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|