About 2-butyl-7-[(1R,2R)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]heptanoic acid
2-butyl-7-[(1R,2R)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]heptanoic acid (PubChem CID 54166411) has the molecular formula C24H44O4
and a molecular weight of 396.61 g/mol. Its IUPAC name is 2-butyl-7-[(1R,2R)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]heptanoic acid.
Molecular Properties
| Compound Name | 2-butyl-7-[(1R,2R)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]heptanoic acid |
| PubChem CID | 54166411 |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | 2-butyl-7-[(1R,2R)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]heptanoic acid |
| SMILES | CCCCCC(O)CC=C1CC[C@@H](O)[C@@H]1CCCCCC(CCCC)C(=O)O |
| InChI | InChI=1S/C24H44O4/c1-3-5-8-13-21(25)17-15-19-16-18-23(26)22(19)14-10-7-9-12-20(24(27)28)11-6-4-2/h15,20-23,25-26H,3-14,16-18H2,1-2H3,(H,27,28)/t20?,21?,22-,23-/m1/s1 |
| InChIKey | ORYKPDLKSGLTQF-BWWMBTDCSA-N |
| XLogP | 5.86 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-7-[(1R,2R)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-7-[(1R,2R)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]heptanoic acid?
The IUPAC name of 2-butyl-7-[(1R,2R)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]heptanoic acid (CID 54166411) is 2-butyl-7-[(1R,2R)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]heptanoic acid.
What is the SMILES notation for 2-butyl-7-[(1R,2R)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]heptanoic acid?
The canonical SMILES for 2-butyl-7-[(1R,2R)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]heptanoic acid is CCCCCC(O)CC=C1CC[C@@H](O)[C@@H]1CCCCCC(CCCC)C(=O)O.
What is the InChIKey of 2-butyl-7-[(1R,2R)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]heptanoic acid?
The InChIKey is ORYKPDLKSGLTQF-BWWMBTDCSA-N. The full InChI is InChI=1S/C24H44O4/c1-3-5-8-13-21(25)17-15-19-16-18-23(26)22(19)14-10-7-9-12-20(24(27)28)11-6-4-2/h15,20-23,25-26H,3-14,16-18H2,1-2H3,(H,27,28)/t20?,21?,22-,23-/m1/s1.
What are the key properties of 2-butyl-7-[(1R,2R)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]heptanoic acid?
2-butyl-7-[(1R,2R)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]heptanoic acid has a molecular weight of 396.61 g/mol, XLogP of 5.86, 16 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-7-[(1R,2R)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]heptanoic acid is sourced from PubChem (CID 54166411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).