C24H42O4 — CID 70616282
propyl 7-[(1R,2S)-2-hydroxy-5-(4-methyl-3-oxooctylidene)cyclopentyl]heptanoate (PubChem CID 70616282) has the molecular formula C24H42O4 and a molecular weight of 394.60 g/mol. Its IUPAC name is propyl 7-[(1R,2S)-2-hydroxy-5-(4-methyl-3-oxooctylidene)cyclopentyl]heptanoate.
| Compound Name | propyl 7-[(1R,2S)-2-hydroxy-5-(4-methyl-3-oxooctylidene)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 70616282 |
| Molecular Formula | C24H42O4 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | propyl 7-[(1R,2S)-2-hydroxy-5-(4-methyl-3-oxooctylidene)cyclopentyl]heptanoate |
| SMILES | CCCCC(C)C(=O)CC=C1CC[C@H](O)[C@@H]1CCCCCCC(=O)OCCC |
| InChI | InChI=1S/C24H42O4/c1-4-6-11-19(3)22(25)16-14-20-15-17-23(26)21(20)12-9-7-8-10-13-24(27)28-18-5-2/h14,19,21,23,26H,4-13,15-18H2,1-3H3/t19?,21-,23+/m1/s1 |
| InChIKey | QWIDEISHAFKKHX-LVPCDLKWSA-N |
| XLogP | 5.76 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|