C23H42O4 — CID 54123585
7-[(1R,2S)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]-2-propylheptanoic acid (PubChem CID 54123585) has the molecular formula C23H42O4 and a molecular weight of 382.59 g/mol. Its IUPAC name is 7-[(1R,2S)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]-2-propylheptanoic acid.
| Compound Name | 7-[(1R,2S)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]-2-propylheptanoic acid |
|---|---|
| PubChem CID | 54123585 |
| Molecular Formula | C23H42O4 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | 7-[(1R,2S)-2-hydroxy-5-(3-hydroxyoctylidene)cyclopentyl]-2-propylheptanoic acid |
| SMILES | CCCCCC(O)CC=C1CC[C@H](O)[C@@H]1CCCCCC(CCC)C(=O)O |
| InChI | InChI=1S/C23H42O4/c1-3-5-7-12-20(24)16-14-18-15-17-22(25)21(18)13-9-6-8-11-19(10-4-2)23(26)27/h14,19-22,24-25H,3-13,15-17H2,1-2H3,(H,26,27)/t19?,20?,21-,22+/m1/s1 |
| InChIKey | NPKQWEBSZJWGFA-XABBQPORSA-N |
| XLogP | 5.47 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|