C26H48O5 — CID 163694737
ethyl 7-[(8S,9R)-8-[(3S)-3-hydroxy-4,4-dimethyloctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate (PubChem CID 163694737) has the molecular formula C26H48O5 and a molecular weight of 440.67 g/mol. Its IUPAC name is ethyl 7-[(8S,9R)-8-[(3S)-3-hydroxy-4,4-dimethyloctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate.
| Compound Name | ethyl 7-[(8S,9R)-8-[(3S)-3-hydroxy-4,4-dimethyloctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate |
|---|---|
| PubChem CID | 163694737 |
| Molecular Formula | C26H48O5 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.35 |
| IUPAC Name | ethyl 7-[(8S,9R)-8-[(3S)-3-hydroxy-4,4-dimethyloctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate |
| SMILES | CCCCC(C)(C)[C@@H](O)CC[C@H]1CCC2(OCCO2)[C@@H]1CCCCCCC(=O)OCC |
| InChI | InChI=1S/C26H48O5/c1-5-7-17-25(3,4)23(27)15-14-21-16-18-26(30-19-20-31-26)22(21)12-10-8-9-11-13-24(28)29-6-2/h21-23,27H,5-20H2,1-4H3/t21-,22+,23-/m0/s1 |
| InChIKey | JVZPQQVQFTZEGZ-ZRBLBEILSA-N |
| XLogP | 6.02 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|