C35H65ClO5 — CID 163963265
decyl 7-[(3R,8S,9R)-3-(chloromethyl)-8-[(3S)-3-hydroxy-4,4-dimethyloctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate (PubChem CID 163963265) has the molecular formula C35H65ClO5 and a molecular weight of 601.35 g/mol. Its IUPAC name is decyl 7-[(3R,8S,9R)-3-(chloromethyl)-8-[(3S)-3-hydroxy-4,4-dimethyloctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate.
| Compound Name | decyl 7-[(3R,8S,9R)-3-(chloromethyl)-8-[(3S)-3-hydroxy-4,4-dimethyloctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate |
|---|---|
| PubChem CID | 163963265 |
| Molecular Formula | C35H65ClO5 |
| Molecular Weight | 601.35 g/mol |
| Exact Mass | 600.45 |
| IUPAC Name | decyl 7-[(3R,8S,9R)-3-(chloromethyl)-8-[(3S)-3-hydroxy-4,4-dimethyloctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate |
| SMILES | CCCCCCCCCCOC(=O)CCCCCC[C@@H]1[C@@H](CC[C@H](O)C(C)(C)CCCC)CCC12OC[C@H](CCl)O2 |
| InChI | InChI=1S/C35H65ClO5/c1-5-7-9-10-11-12-15-18-26-39-33(38)20-17-14-13-16-19-31-29(21-22-32(37)34(3,4)24-8-6-2)23-25-35(31)40-28-30(27-36)41-35/h29-32,37H,5-28H2,1-4H3/t29-,30-,31+,32-,35?/m0/s1 |
| InChIKey | SJJFYZXGLRBBSK-KHGAUMIWSA-N |
| XLogP | 9.75 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.35 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|