C31H57ClO5 — CID 163802780
octyl 7-[(8S,9R)-3-(chloromethyl)-8-[(3S)-3-hydroxyoctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate (PubChem CID 163802780) has the molecular formula C31H57ClO5 and a molecular weight of 545.25 g/mol. Its IUPAC name is octyl 7-[(8S,9R)-3-(chloromethyl)-8-[(3S)-3-hydroxyoctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate.
| Compound Name | octyl 7-[(8S,9R)-3-(chloromethyl)-8-[(3S)-3-hydroxyoctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate |
|---|---|
| PubChem CID | 163802780 |
| Molecular Formula | C31H57ClO5 |
| Molecular Weight | 545.25 g/mol |
| Exact Mass | 544.39 |
| IUPAC Name | octyl 7-[(8S,9R)-3-(chloromethyl)-8-[(3S)-3-hydroxyoctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate |
| SMILES | CCCCCCCCOC(=O)CCCCCC[C@@H]1[C@@H](CC[C@@H](O)CCCCC)CCC12OCC(CCl)O2 |
| InChI | InChI=1S/C31H57ClO5/c1-3-5-7-8-11-15-23-35-30(34)18-14-10-9-13-17-29-26(19-20-27(33)16-12-6-4-2)21-22-31(29)36-25-28(24-32)37-31/h26-29,33H,3-25H2,1-2H3/t26-,27-,28?,29+,31?/m0/s1 |
| InChIKey | NGLFPEBGZCDNCD-SIFRXSHLSA-N |
| XLogP | 8.33 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.25 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|