C27H42O4 — CID 154086847
methyl 7-[(1R,2S)-2-(3-hydroxy-3-phenyloctyl)-5-oxocyclopentyl]heptanoate (PubChem CID 154086847) has the molecular formula C27H42O4 and a molecular weight of 430.63 g/mol. Its IUPAC name is methyl 7-[(1R,2S)-2-(3-hydroxy-3-phenyloctyl)-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2S)-2-(3-hydroxy-3-phenyloctyl)-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 154086847 |
| Molecular Formula | C27H42O4 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | methyl 7-[(1R,2S)-2-(3-hydroxy-3-phenyloctyl)-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCCC(O)(CC[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C27H42O4/c1-3-4-12-20-27(30,23-13-8-7-9-14-23)21-19-22-17-18-25(28)24(22)15-10-5-6-11-16-26(29)31-2/h7-9,13-14,22,24,30H,3-6,10-12,15-21H2,1-2H3/t22-,24-,27?/m1/s1 |
| InChIKey | WEZWUBZQKCMHGY-QEHQQCFTSA-N |
| XLogP | 6.34 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|