C24H42F2O5 — CID 144503950
methyl 7-[(5S)-2-acetyloxy-5-[(6S)-4,4-difluoro-3-hydroxy-6-methyloctyl]cyclopentyl]heptanoate (PubChem CID 144503950) has the molecular formula C24H42F2O5 and a molecular weight of 448.59 g/mol. Its IUPAC name is methyl 7-[(5S)-2-acetyloxy-5-[(6S)-4,4-difluoro-3-hydroxy-6-methyloctyl]cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(5S)-2-acetyloxy-5-[(6S)-4,4-difluoro-3-hydroxy-6-methyloctyl]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 144503950 |
| Molecular Formula | C24H42F2O5 |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | methyl 7-[(5S)-2-acetyloxy-5-[(6S)-4,4-difluoro-3-hydroxy-6-methyloctyl]cyclopentyl]heptanoate |
| SMILES | CC[C@H](C)CC(F)(F)C(O)CC[C@H]1CCC(OC(C)=O)C1CCCCCCC(=O)OC |
| InChI | InChI=1S/C24H42F2O5/c1-5-17(2)16-24(25,26)22(28)15-13-19-12-14-21(31-18(3)27)20(19)10-8-6-7-9-11-23(29)30-4/h17,19-22,28H,5-16H2,1-4H3/t17-,19+,20?,21?,22?/m0/s1 |
| InChIKey | PYAWOBJOPFMDPG-LFGNLZFBSA-N |
| XLogP | 5.67 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|