C33H52F2O6 — CID 71149931
benzyl 7-[(1R,2R,3R,5R)-2-[(6S)-4,4-difluoro-3-hydroxy-6-methyloctyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoate (PubChem CID 71149931) has the molecular formula C33H52F2O6 and a molecular weight of 582.77 g/mol. Its IUPAC name is benzyl 7-[(1R,2R,3R,5R)-2-[(6S)-4,4-difluoro-3-hydroxy-6-methyloctyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoate.
| Compound Name | benzyl 7-[(1R,2R,3R,5R)-2-[(6S)-4,4-difluoro-3-hydroxy-6-methyloctyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 71149931 |
| Molecular Formula | C33H52F2O6 |
| Molecular Weight | 582.77 g/mol |
| Exact Mass | 582.37 |
| IUPAC Name | benzyl 7-[(1R,2R,3R,5R)-2-[(6S)-4,4-difluoro-3-hydroxy-6-methyloctyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
| SMILES | CC[C@H](C)CC(F)(F)C(O)CC[C@@H]1[C@@H](CCCCCCC(=O)OCc2ccccc2)[C@H](O)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C33H52F2O6/c1-3-24(2)22-33(34,35)30(37)19-18-27-26(28(36)21-29(27)41-32-17-11-12-20-39-32)15-9-4-5-10-16-31(38)40-23-25-13-7-6-8-14-25/h6-8,13-14,24,26-30,32,36-37H,3-5,9-12,15-23H2,1-2H3/t24-,26+,27+,28+,29+,30?,32?/m0/s1 |
| InChIKey | JPPOBLSEMNRBEN-YVPBAQKHSA-N |
| XLogP | 7.19 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.77 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|