C23H34O5 — CID 22796217
2-[(2S,3S,5R)-5-hydroxy-2-(3-hydroxy-4-phenylpentyl)-3-(oxan-2-yloxy)cyclopentyl]acetaldehyde (PubChem CID 22796217) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is 2-[(2S,3S,5R)-5-hydroxy-2-(3-hydroxy-4-phenylpentyl)-3-(oxan-2-yloxy)cyclopentyl]acetaldehyde.
| Compound Name | 2-[(2S,3S,5R)-5-hydroxy-2-(3-hydroxy-4-phenylpentyl)-3-(oxan-2-yloxy)cyclopentyl]acetaldehyde |
|---|---|
| PubChem CID | 22796217 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 2-[(2S,3S,5R)-5-hydroxy-2-(3-hydroxy-4-phenylpentyl)-3-(oxan-2-yloxy)cyclopentyl]acetaldehyde |
| SMILES | CC(c1ccccc1)C(O)CC[C@H]1C(CC=O)[C@H](O)C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C23H34O5/c1-16(17-7-3-2-4-8-17)20(25)11-10-19-18(12-13-24)21(26)15-22(19)28-23-9-5-6-14-27-23/h2-4,7-8,13,16,18-23,25-26H,5-6,9-12,14-15H2,1H3/t16?,18?,19-,20?,21+,22-,23?/m0/s1 |
| InChIKey | IQWHESBCJCBNND-RZOSOEAPSA-N |
| XLogP | 3.43 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|