C25H38O6S — CID 88796166
2-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[1-(oxan-2-yloxy)-4-thiophen-2-ylbutyl]cyclopentyl]acetaldehyde (PubChem CID 88796166) has the molecular formula C25H38O6S and a molecular weight of 466.64 g/mol. Its IUPAC name is 2-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[1-(oxan-2-yloxy)-4-thiophen-2-ylbutyl]cyclopentyl]acetaldehyde.
| Compound Name | 2-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[1-(oxan-2-yloxy)-4-thiophen-2-ylbutyl]cyclopentyl]acetaldehyde |
|---|---|
| PubChem CID | 88796166 |
| Molecular Formula | C25H38O6S |
| Molecular Weight | 466.64 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 2-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[1-(oxan-2-yloxy)-4-thiophen-2-ylbutyl]cyclopentyl]acetaldehyde |
| SMILES | O=CC[C@@H]1[C@H](C(CCCc2cccs2)OC2CCCCO2)[C@H](OC2CCCCO2)C[C@@H]1O |
| InChI | InChI=1S/C25H38O6S/c26-13-12-19-20(27)17-22(31-24-11-2-4-15-29-24)25(19)21(30-23-10-1-3-14-28-23)9-5-7-18-8-6-16-32-18/h6,8,13,16,19-25,27H,1-5,7,9-12,14-15,17H2/t19-,20-,21?,22+,23?,24?,25+/m0/s1 |
| InChIKey | BXYLDFZHKRUPIF-ZFYSSQMRSA-N |
| XLogP | 4.48 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.64 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|