C33H50O7 — CID 11330416
2-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(3R)-3-(oxan-2-yloxy)-5-phenylpentyl]cyclopentyl]acetaldehyde (PubChem CID 11330416) has the molecular formula C33H50O7 and a molecular weight of 558.76 g/mol. Its IUPAC name is 2-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(3R)-3-(oxan-2-yloxy)-5-phenylpentyl]cyclopentyl]acetaldehyde.
| Compound Name | 2-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(3R)-3-(oxan-2-yloxy)-5-phenylpentyl]cyclopentyl]acetaldehyde |
|---|---|
| PubChem CID | 11330416 |
| Molecular Formula | C33H50O7 |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.36 |
| IUPAC Name | 2-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(3R)-3-(oxan-2-yloxy)-5-phenylpentyl]cyclopentyl]acetaldehyde |
| SMILES | O=CC[C@@H]1[C@@H](CC[C@H](CCc2ccccc2)OC2CCCCO2)[C@H](OC2CCCCO2)C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C33H50O7/c34-20-19-28-27(18-17-26(38-31-12-4-7-21-35-31)16-15-25-10-2-1-3-11-25)29(39-32-13-5-8-22-36-32)24-30(28)40-33-14-6-9-23-37-33/h1-3,10-11,20,26-33H,4-9,12-19,21-24H2/t26-,27+,28+,29+,30-,31?,32?,33?/m0/s1 |
| InChIKey | GJXMTHJLQQTGOD-QOMRVEFUSA-N |
| XLogP | 6.36 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|