C26H44F2O6 — CID 162547036
7-[(2R,3R,5S)-2-(4,4-difluoro-7-methyl-3-oxooctyl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid (PubChem CID 162547036) has the molecular formula C26H44F2O6 and a molecular weight of 490.63 g/mol. Its IUPAC name is 7-[(2R,3R,5S)-2-(4,4-difluoro-7-methyl-3-oxooctyl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid.
| Compound Name | 7-[(2R,3R,5S)-2-(4,4-difluoro-7-methyl-3-oxooctyl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 162547036 |
| Molecular Formula | C26H44F2O6 |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | 7-[(2R,3R,5S)-2-(4,4-difluoro-7-methyl-3-oxooctyl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid |
| SMILES | CC(C)CCC(F)(F)C(=O)CC[C@@H]1C(CCCCCCC(=O)O)[C@@H](O)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C26H44F2O6/c1-18(2)14-15-26(27,28)23(30)13-12-20-19(9-5-3-4-6-10-24(31)32)21(29)17-22(20)34-25-11-7-8-16-33-25/h18-22,25,29H,3-17H2,1-2H3,(H,31,32)/t19?,20-,21+,22-,25?/m1/s1 |
| InChIKey | RXFSTCNZLJSQKA-NJNVXGHCSA-N |
| XLogP | 5.74 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|