C16H26O5 — CID 21319559
methyl 7-(2-acetyloxy-5-formylcyclopentyl)heptanoate (PubChem CID 21319559) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is methyl 7-(2-acetyloxy-5-formylcyclopentyl)heptanoate.
| Compound Name | methyl 7-(2-acetyloxy-5-formylcyclopentyl)heptanoate |
|---|---|
| PubChem CID | 21319559 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | methyl 7-(2-acetyloxy-5-formylcyclopentyl)heptanoate |
| SMILES | COC(=O)CCCCCCC1C(C=O)CCC1OC(C)=O |
| InChI | InChI=1S/C16H26O5/c1-12(18)21-15-10-9-13(11-17)14(15)7-5-3-4-6-8-16(19)20-2/h11,13-15H,3-10H2,1-2H3 |
| InChIKey | VOXQEOGZIDEDLI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|