C23H31NO7 — CID 88552950
methyl 7-[(2R,5S)-5-acetyloxy-2-formyl-3-(phenoxycarbonylamino)cyclopentyl]heptanoate (PubChem CID 88552950) has the molecular formula C23H31NO7 and a molecular weight of 433.50 g/mol. Its IUPAC name is methyl 7-[(2R,5S)-5-acetyloxy-2-formyl-3-(phenoxycarbonylamino)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(2R,5S)-5-acetyloxy-2-formyl-3-(phenoxycarbonylamino)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 88552950 |
| Molecular Formula | C23H31NO7 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | methyl 7-[(2R,5S)-5-acetyloxy-2-formyl-3-(phenoxycarbonylamino)cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCCC1[C@@H](C=O)C(NC(=O)Oc2ccccc2)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H31NO7/c1-16(26)30-21-14-20(24-23(28)31-17-10-6-5-7-11-17)19(15-25)18(21)12-8-3-4-9-13-22(27)29-2/h5-7,10-11,15,18-21H,3-4,8-9,12-14H2,1-2H3,(H,24,28)/t18?,19-,20?,21+/m1/s1 |
| InChIKey | MKNNAVQWRIAHDN-KOQKOIQBSA-N |
| XLogP | 3.42 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|