C24H33NO7 — CID 89245744
methyl 7-[(1R,2R,5S)-5-acetyloxy-2-formyl-3-(phenylmethoxycarbonylamino)cyclopentyl]heptanoate (PubChem CID 89245744) has the molecular formula C24H33NO7 and a molecular weight of 447.53 g/mol. Its IUPAC name is methyl 7-[(1R,2R,5S)-5-acetyloxy-2-formyl-3-(phenylmethoxycarbonylamino)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,5S)-5-acetyloxy-2-formyl-3-(phenylmethoxycarbonylamino)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 89245744 |
| Molecular Formula | C24H33NO7 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | methyl 7-[(1R,2R,5S)-5-acetyloxy-2-formyl-3-(phenylmethoxycarbonylamino)cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@H]1[C@@H](OC(C)=O)CC(NC(=O)OCc2ccccc2)[C@@H]1C=O |
| InChI | InChI=1S/C24H33NO7/c1-17(27)32-22-14-21(25-24(29)31-16-18-10-6-5-7-11-18)20(15-26)19(22)12-8-3-4-9-13-23(28)30-2/h5-7,10-11,15,19-22H,3-4,8-9,12-14,16H2,1-2H3,(H,25,29)/t19-,20-,21?,22+/m1/s1 |
| InChIKey | MDHLEMPJALUOFA-ZTTSMYDPSA-N |
| XLogP | 3.56 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|