C17H28O5 — CID 88839224
methyl 7-[(1R,2S,3R)-5-ethenylperoxy-2-formyl-3-methylcyclopentyl]heptanoate (PubChem CID 88839224) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is methyl 7-[(1R,2S,3R)-5-ethenylperoxy-2-formyl-3-methylcyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2S,3R)-5-ethenylperoxy-2-formyl-3-methylcyclopentyl]heptanoate |
|---|---|
| PubChem CID | 88839224 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | methyl 7-[(1R,2S,3R)-5-ethenylperoxy-2-formyl-3-methylcyclopentyl]heptanoate |
| SMILES | C=COOC1C[C@@H](C)[C@H](C=O)[C@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C17H28O5/c1-4-21-22-16-11-13(2)15(12-18)14(16)9-7-5-6-8-10-17(19)20-3/h4,12-16H,1,5-11H2,2-3H3/t13-,14-,15+,16?/m1/s1 |
| InChIKey | HIGVIOHZQTXJSQ-JZWPEALZSA-N |
| XLogP | 3.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|